C8H13NS — CID 71412408
2-ethyl-4,5-dimethylthiophen-3-amine (PubChem CID 71412408) has the molecular formula C8H13NS and a molecular weight of 155.27 g/mol. Its IUPAC name is 2-ethyl-4,5-dimethylthiophen-3-amine.
| Compound Name | 2-ethyl-4,5-dimethylthiophen-3-amine |
|---|---|
| PubChem CID | 71412408 |
| Molecular Formula | C8H13NS |
| Molecular Weight | 155.27 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | 2-ethyl-4,5-dimethylthiophen-3-amine |
| SMILES | CCc1sc(C)c(C)c1N |
| InChI | InChI=1S/C8H13NS/c1-4-7-8(9)5(2)6(3)10-7/h4,9H2,1-3H3 |
| InChIKey | WIHMYRZYDKEVEF-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.27 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |