C9H7F3N2S — CID 167407425
N'-[2-(trifluoromethyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-3-yl]methanediimine (PubChem CID 167407425) has the molecular formula C9H7F3N2S and a molecular weight of 232.23 g/mol. Its IUPAC name is N'-[2-(trifluoromethyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-3-yl]methanediimine.
| Compound Name | N'-[2-(trifluoromethyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-3-yl]methanediimine |
|---|---|
| PubChem CID | 167407425 |
| Molecular Formula | C9H7F3N2S |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | N'-[2-(trifluoromethyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-3-yl]methanediimine |
| SMILES | N=C=Nc1c(C(F)(F)F)sc2c1CCC2 |
| InChI | InChI=1S/C9H7F3N2S/c10-9(11,12)8-7(14-4-13)5-2-1-3-6(5)15-8/h13H,1-3H2 |
| InChIKey | VJDPJFYVWWILIF-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|