C22H21N3O5 — CID 59952936
(10R)-4-acetyl-2-oxo-8-[(E)-(2-oxo-1-phenylpyrrolidin-3-ylidene)methyl]-1,4-diazatricyclo[4.3.1.03,10]dec-8-ene-9-carboxylic acid (PubChem CID 59952936) has the molecular formula C22H21N3O5 and a molecular weight of 407.43 g/mol. Its IUPAC name is (10R)-4-acetyl-2-oxo-8-[(E)-(2-oxo-1-phenylpyrrolidin-3-ylidene)methyl]-1,4-diazatricyclo[4.3.1.03,10]dec-8-ene-9-carboxylic acid.
| Compound Name | (10R)-4-acetyl-2-oxo-8-[(E)-(2-oxo-1-phenylpyrrolidin-3-ylidene)methyl]-1,4-diazatricyclo[4.3.1.03,10]dec-8-ene-9-carboxylic acid |
|---|---|
| PubChem CID | 59952936 |
| Molecular Formula | C22H21N3O5 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | (10R)-4-acetyl-2-oxo-8-[(E)-(2-oxo-1-phenylpyrrolidin-3-ylidene)methyl]-1,4-diazatricyclo[4.3.1.03,10]dec-8-ene-9-carboxylic acid |
| SMILES | CC(=O)N1CC2CC(/C=C3\CCN(c4ccccc4)C3=O)=C(C(=O)O)N3C(=O)C1[C@@H]23 |
| InChI | InChI=1S/C22H21N3O5/c1-12(26)24-11-15-10-14(18(22(29)30)25-17(15)19(24)21(25)28)9-13-7-8-23(20(13)27)16-5-3-2-4-6-16/h2-6,9,15,17,19H,7-8,10-11H2,1H3,(H,29,30)/b13-9+/t15?,17-,19?/m1/s1 |
| InChIKey | WAQCAVPFNOKDMB-MMRNIKSGSA-N |
| XLogP | 1.15 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|