C18H32O8 — CID 59955753
3-[hydroxy-bis(5-hydroxypentoxy)methyl]-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 59955753) has the molecular formula C18H32O8 and a molecular weight of 376.45 g/mol. Its IUPAC name is 3-[hydroxy-bis(5-hydroxypentoxy)methyl]-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | 3-[hydroxy-bis(5-hydroxypentoxy)methyl]-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 59955753 |
| Molecular Formula | C18H32O8 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | 3-[hydroxy-bis(5-hydroxypentoxy)methyl]-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | O=C(O)C1C2CCC(O2)C1C(O)(OCCCCCO)OCCCCCO |
| InChI | InChI=1S/C18H32O8/c19-9-3-1-5-11-24-18(23,25-12-6-2-4-10-20)16-14-8-7-13(26-14)15(16)17(21)22/h13-16,19-20,23H,1-12H2,(H,21,22) |
| InChIKey | VIZQXIFJLJQFNT-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|