C24H30F3NO2 — CID 59956800
(Z)-6-[(1R,2S,3S,4S)-3-[[[4-methyl-2-(trifluoromethyl)phenyl]methylamino]methyl]-2-bicyclo[2.2.2]oct-5-enyl]hex-5-enoic acid (PubChem CID 59956800) has the molecular formula C24H30F3NO2 and a molecular weight of 421.50 g/mol. Its IUPAC name is (Z)-6-[(1R,2S,3S,4S)-3-[[[4-methyl-2-(trifluoromethyl)phenyl]methylamino]methyl]-2-bicyclo[2.2.2]oct-5-enyl]hex-5-enoic acid.
| Compound Name | (Z)-6-[(1R,2S,3S,4S)-3-[[[4-methyl-2-(trifluoromethyl)phenyl]methylamino]methyl]-2-bicyclo[2.2.2]oct-5-enyl]hex-5-enoic acid |
|---|---|
| PubChem CID | 59956800 |
| Molecular Formula | C24H30F3NO2 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | (Z)-6-[(1R,2S,3S,4S)-3-[[[4-methyl-2-(trifluoromethyl)phenyl]methylamino]methyl]-2-bicyclo[2.2.2]oct-5-enyl]hex-5-enoic acid |
| SMILES | Cc1ccc(CNC[C@@H]2[C@@H](/C=C\CCCC(=O)O)[C@H]3C=C[C@@H]2CC3)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H30F3NO2/c1-16-7-8-19(22(13-16)24(25,26)27)14-28-15-21-18-11-9-17(10-12-18)20(21)5-3-2-4-6-23(29)30/h3,5,7-9,11,13,17-18,20-21,28H,2,4,6,10,12,14-15H2,1H3,(H,29,30)/b5-3-/t17-,18+,20-,21-/m0/s1 |
| InChIKey | MGZMTDHCASXMFM-OYDUWBJASA-N |
| XLogP | 5.74 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|