C22H47NO — CID 59957249
4-methoxy-5,6-dimethylnonadecan-3-amine (PubChem CID 59957249) has the molecular formula C22H47NO and a molecular weight of 341.62 g/mol. Its IUPAC name is 4-methoxy-5,6-dimethylnonadecan-3-amine.
| Compound Name | 4-methoxy-5,6-dimethylnonadecan-3-amine |
|---|---|
| PubChem CID | 59957249 |
| Molecular Formula | C22H47NO |
| Molecular Weight | 341.62 g/mol |
| Exact Mass | 341.37 |
| IUPAC Name | 4-methoxy-5,6-dimethylnonadecan-3-amine |
| SMILES | CCCCCCCCCCCCCC(C)C(C)C(OC)C(N)CC |
| InChI | InChI=1S/C22H47NO/c1-6-8-9-10-11-12-13-14-15-16-17-18-19(3)20(4)22(24-5)21(23)7-2/h19-22H,6-18,23H2,1-5H3 |
| InChIKey | IVXSVYUUKBOVRT-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.62 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|