C33H53NO6 — CID 59957444
[(10S,13R)-17-[5-(2-cyanoethoxy)-5-oxopentan-2-yl]-7,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2,2-dimethylbutanoate (PubChem CID 59957444) has the molecular formula C33H53NO6 and a molecular weight of 559.79 g/mol. Its IUPAC name is [(10S,13R)-17-[5-(2-cyanoethoxy)-5-oxopentan-2-yl]-7,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2,2-dimethylbutanoate.
| Compound Name | [(10S,13R)-17-[5-(2-cyanoethoxy)-5-oxopentan-2-yl]-7,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 59957444 |
| Molecular Formula | C33H53NO6 |
| Molecular Weight | 559.79 g/mol |
| Exact Mass | 559.39 |
| IUPAC Name | [(10S,13R)-17-[5-(2-cyanoethoxy)-5-oxopentan-2-yl]-7,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1CC[C@@]2(C)C(C1)CC(O)C1C2CC(O)[C@]2(C)C(C(C)CCC(=O)OCCC#N)CCC12 |
| InChI | InChI=1S/C33H53NO6/c1-7-31(3,4)30(38)40-22-13-14-32(5)21(17-22)18-26(35)29-24-11-10-23(33(24,6)27(36)19-25(29)32)20(2)9-12-28(37)39-16-8-15-34/h20-27,29,35-36H,7-14,16-19H2,1-6H3/t20?,21?,22?,23?,24?,25?,26?,27?,29?,32-,33+/m0/s1 |
| InChIKey | NCWBABLLVZIBIP-XKQSCZHMSA-N |
| XLogP | 5.81 |
| TPSA | 116.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.79 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|