C32H51NO5 — CID 59957524
2-cyanoethyl 4-[(10S,13R)-12-hydroxy-10,13-dimethyl-3-(2-methylbutanoyloxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 59957524) has the molecular formula C32H51NO5 and a molecular weight of 529.76 g/mol. Its IUPAC name is 2-cyanoethyl 4-[(10S,13R)-12-hydroxy-10,13-dimethyl-3-(2-methylbutanoyloxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | 2-cyanoethyl 4-[(10S,13R)-12-hydroxy-10,13-dimethyl-3-(2-methylbutanoyloxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 59957524 |
| Molecular Formula | C32H51NO5 |
| Molecular Weight | 529.76 g/mol |
| Exact Mass | 529.38 |
| IUPAC Name | 2-cyanoethyl 4-[(10S,13R)-12-hydroxy-10,13-dimethyl-3-(2-methylbutanoyloxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | CCC(C)C(=O)OC1CC[C@@]2(C)C(CCC3C2CC(O)[C@]2(C)C(C(C)CCC(=O)OCCC#N)CCC32)C1 |
| InChI | InChI=1S/C32H51NO5/c1-6-20(2)30(36)38-23-14-15-31(4)22(18-23)9-10-24-26-12-11-25(32(26,5)28(34)19-27(24)31)21(3)8-13-29(35)37-17-7-16-33/h20-28,34H,6-15,17-19H2,1-5H3/t20?,21?,22?,23?,24?,25?,26?,27?,28?,31-,32+/m0/s1 |
| InChIKey | DEHCOQWLFLGPED-AVGCZMCOSA-N |
| XLogP | 6.45 |
| TPSA | 96.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.76 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|