C32H52N2O4 — CID 59957452
[(10S,13R)-17-[5-(2-cyanoethylamino)-5-oxopentan-2-yl]-12-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-methylbutanoate (PubChem CID 59957452) has the molecular formula C32H52N2O4 and a molecular weight of 528.78 g/mol. Its IUPAC name is [(10S,13R)-17-[5-(2-cyanoethylamino)-5-oxopentan-2-yl]-12-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-methylbutanoate.
| Compound Name | [(10S,13R)-17-[5-(2-cyanoethylamino)-5-oxopentan-2-yl]-12-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-methylbutanoate |
|---|---|
| PubChem CID | 59957452 |
| Molecular Formula | C32H52N2O4 |
| Molecular Weight | 528.78 g/mol |
| Exact Mass | 528.39 |
| IUPAC Name | [(10S,13R)-17-[5-(2-cyanoethylamino)-5-oxopentan-2-yl]-12-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC1CC[C@@]2(C)C(CCC3C2CC(O)[C@]2(C)C(C(C)CCC(=O)NCCC#N)CCC32)C1 |
| InChI | InChI=1S/C32H52N2O4/c1-6-20(2)30(37)38-23-14-15-31(4)22(18-23)9-10-24-26-12-11-25(32(26,5)28(35)19-27(24)31)21(3)8-13-29(36)34-17-7-16-33/h20-28,35H,6-15,17-19H2,1-5H3,(H,34,36)/t20?,21?,22?,23?,24?,25?,26?,27?,28?,31-,32+/m0/s1 |
| InChIKey | NITSUGTVIXKGHC-AVGCZMCOSA-N |
| XLogP | 6.02 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.78 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|