C23H25BN2O8 — CID 59958038
CID 59958038 (PubChem CID 59958038) has the molecular formula C23H25BN2O8 and a molecular weight of 468.27 g/mol.
| Compound Name | CID 59958038 |
|---|---|
| PubChem CID | 59958038 |
| Molecular Formula | C23H25BN2O8 |
| Molecular Weight | 468.27 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | — |
| SMILES | [B]C(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)COc1c(C(=O)O)ccc2ccccc12 |
| InChI | InChI=1S/C23H25BN2O8/c1-12(2)9-17(22(31)26-16(21(24)30)10-19(28)29)25-18(27)11-34-20-14-6-4-3-5-13(14)7-8-15(20)23(32)33/h3-8,12,16-17H,9-11H2,1-2H3,(H,25,27)(H,26,31)(H,28,29)(H,32,33)/t16-,17-/m0/s1 |
| InChIKey | SDTQICJIHYNTRF-IRXDYDNUSA-N |
| XLogP | 1.10 |
| TPSA | 159.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.27 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|