C18H24N2O2 — CID 59958370
2,6,6-trimethyl-4-[(3,5,5-trimethyl-4-oxocyclohex-2-en-1-ylidene)hydrazinylidene]cyclohex-2-en-1-one (PubChem CID 59958370) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is 2,6,6-trimethyl-4-[(3,5,5-trimethyl-4-oxocyclohex-2-en-1-ylidene)hydrazinylidene]cyclohex-2-en-1-one.
| Compound Name | 2,6,6-trimethyl-4-[(3,5,5-trimethyl-4-oxocyclohex-2-en-1-ylidene)hydrazinylidene]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 59958370 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 2,6,6-trimethyl-4-[(3,5,5-trimethyl-4-oxocyclohex-2-en-1-ylidene)hydrazinylidene]cyclohex-2-en-1-one |
| SMILES | CC1=CC(=NN=C2C=C(C)C(=O)C(C)(C)C2)CC(C)(C)C1=O |
| InChI | InChI=1S/C18H24N2O2/c1-11-7-13(9-17(3,4)15(11)21)19-20-14-8-12(2)16(22)18(5,6)10-14/h7-8H,9-10H2,1-6H3 |
| InChIKey | OPMJVUWWLBHOPE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|