C8H16O — CID 59959641
2,3,5-trimethyloxane (PubChem CID 59959641) has the molecular formula C8H16O and a molecular weight of 128.21 g/mol. Its IUPAC name is 2,3,5-trimethyloxane.
| Compound Name | 2,3,5-trimethyloxane |
|---|---|
| PubChem CID | 59959641 |
| Molecular Formula | C8H16O |
| Molecular Weight | 128.21 g/mol |
| Exact Mass | 128.12 |
| IUPAC Name | 2,3,5-trimethyloxane |
| SMILES | CC1COC(C)C(C)C1 |
| InChI | InChI=1S/C8H16O/c1-6-4-7(2)8(3)9-5-6/h6-8H,4-5H2,1-3H3 |
| InChIKey | BTOPWLXHISHMIX-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.21 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |