C26H30INO8 — CID 59960262
prop-2-enyl (4S)-3-[[4-(2-hydroxyethyl)-2-iodophenoxy]methyl]-4-methyl-7-oxo-6-(1-oxo-1-prop-2-enylperoxypropan-2-yl)-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 59960262) has the molecular formula C26H30INO8 and a molecular weight of 611.43 g/mol. Its IUPAC name is prop-2-enyl (4S)-3-[[4-(2-hydroxyethyl)-2-iodophenoxy]methyl]-4-methyl-7-oxo-6-(1-oxo-1-prop-2-enylperoxypropan-2-yl)-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | prop-2-enyl (4S)-3-[[4-(2-hydroxyethyl)-2-iodophenoxy]methyl]-4-methyl-7-oxo-6-(1-oxo-1-prop-2-enylperoxypropan-2-yl)-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 59960262 |
| Molecular Formula | C26H30INO8 |
| Molecular Weight | 611.43 g/mol |
| Exact Mass | 611.10 |
| IUPAC Name | prop-2-enyl (4S)-3-[[4-(2-hydroxyethyl)-2-iodophenoxy]methyl]-4-methyl-7-oxo-6-(1-oxo-1-prop-2-enylperoxypropan-2-yl)-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | C=CCOOC(=O)C(C)C1C(=O)N2C(C(=O)OCC=C)=C(COc3ccc(CCO)cc3I)[C@H](C)C12 |
| InChI | InChI=1S/C26H30INO8/c1-5-11-33-26(32)23-18(14-34-20-8-7-17(9-10-29)13-19(20)27)15(3)22-21(24(30)28(22)23)16(4)25(31)36-35-12-6-2/h5-8,13,15-16,21-22,29H,1-2,9-12,14H2,3-4H3/t15-,16?,21?,22?/m0/s1 |
| InChIKey | YMGISZWIUOSXOR-ALXQUSRKSA-N |
| XLogP | 2.96 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|