C11H14N5O6P — CID 59960750
(4aS,6S)-6-[(6-aminopurin-9-yl)methyl]-2-hydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-ol (PubChem CID 59960750) has the molecular formula C11H14N5O6P and a molecular weight of 343.24 g/mol. Its IUPAC name is (4aS,6S)-6-[(6-aminopurin-9-yl)methyl]-2-hydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-ol.
| Compound Name | (4aS,6S)-6-[(6-aminopurin-9-yl)methyl]-2-hydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-ol |
|---|---|
| PubChem CID | 59960750 |
| Molecular Formula | C11H14N5O6P |
| Molecular Weight | 343.24 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | (4aS,6S)-6-[(6-aminopurin-9-yl)methyl]-2-hydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-ol |
| SMILES | Nc1ncnc2c1ncn2C[C@@H]1O[C@H]2COP(=O)(O)OC2C1O |
| InChI | InChI=1S/C11H14N5O6P/c12-10-7-11(14-3-13-10)16(4-15-7)1-5-8(17)9-6(21-5)2-20-23(18,19)22-9/h3-6,8-9,17H,1-2H2,(H,18,19)(H2,12,13,14)/t5-,6-,8?,9?/m0/s1 |
| InChIKey | QUIIUYUVPUVFRJ-VABKVPQOSA-N |
| XLogP | -0.95 |
| TPSA | 154.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.24 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|