C13H23N3O2 — CID 59961752
5-[(2R,3R)-1-azido-2,3,4-trimethylhexyl]oxolan-2-one (PubChem CID 59961752) has the molecular formula C13H23N3O2 and a molecular weight of 253.35 g/mol. Its IUPAC name is 5-[(2R,3R)-1-azido-2,3,4-trimethylhexyl]oxolan-2-one.
| Compound Name | 5-[(2R,3R)-1-azido-2,3,4-trimethylhexyl]oxolan-2-one |
|---|---|
| PubChem CID | 59961752 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 5-[(2R,3R)-1-azido-2,3,4-trimethylhexyl]oxolan-2-one |
| SMILES | CCC(C)[C@@H](C)[C@@H](C)C(N=[N+]=[N-])C1CCC(=O)O1 |
| InChI | InChI=1S/C13H23N3O2/c1-5-8(2)9(3)10(4)13(15-16-14)11-6-7-12(17)18-11/h8-11,13H,5-7H2,1-4H3/t8?,9-,10-,11?,13?/m1/s1 |
| InChIKey | RTIVIIICNOSFOV-CIPXATDKSA-N |
| XLogP | 3.69 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|