C11H19NO3 — CID 59961753
(1R,2S)-8-hydroxy-3-(hydroxymethyl)-1,2-dimethyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one (PubChem CID 59961753) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is (1R,2S)-8-hydroxy-3-(hydroxymethyl)-1,2-dimethyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one.
| Compound Name | (1R,2S)-8-hydroxy-3-(hydroxymethyl)-1,2-dimethyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 59961753 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | (1R,2S)-8-hydroxy-3-(hydroxymethyl)-1,2-dimethyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
| SMILES | C[C@@H]1C(CO)N2C(=O)CCC(O)C2[C@@H]1C |
| InChI | InChI=1S/C11H19NO3/c1-6-7(2)11-9(14)3-4-10(15)12(11)8(6)5-13/h6-9,11,13-14H,3-5H2,1-2H3/t6-,7+,8?,9?,11?/m0/s1 |
| InChIKey | CHTMALAODCKSFE-PDOKLOBBSA-N |
| XLogP | -0.01 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |