C15H26FO4P — CID 59963489
(4R)-4-(4-fluoro-3-hydroxyoctyl)-5-phosphanyloxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 59963489) has the molecular formula C15H26FO4P and a molecular weight of 320.34 g/mol. Its IUPAC name is (4R)-4-(4-fluoro-3-hydroxyoctyl)-5-phosphanyloxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (4R)-4-(4-fluoro-3-hydroxyoctyl)-5-phosphanyloxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 59963489 |
| Molecular Formula | C15H26FO4P |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | (4R)-4-(4-fluoro-3-hydroxyoctyl)-5-phosphanyloxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CCCCC(F)C(O)CC[C@H]1C(OP)CC2OC(=O)CC21 |
| InChI | InChI=1S/C15H26FO4P/c1-2-3-4-11(16)12(17)6-5-9-10-7-15(18)19-13(10)8-14(9)20-21/h9-14,17H,2-8,21H2,1H3/t9-,10?,11?,12?,13?,14?/m1/s1 |
| InChIKey | LTVRMHNJYBUBEF-UIBFTYAWSA-N |
| XLogP | 2.78 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|