C8H13NaO7S3 — CID 59964454
sodium 4-ethenoxysulfinyl-4-ethenylsulfinyloxybutane-1-sulfonate (PubChem CID 59964454) has the molecular formula C8H13NaO7S3 and a molecular weight of 340.38 g/mol. Its IUPAC name is sodium 4-ethenoxysulfinyl-4-ethenylsulfinyloxybutane-1-sulfonate.
| Compound Name | sodium 4-ethenoxysulfinyl-4-ethenylsulfinyloxybutane-1-sulfonate |
|---|---|
| PubChem CID | 59964454 |
| Molecular Formula | C8H13NaO7S3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 339.97 |
| IUPAC Name | sodium 4-ethenoxysulfinyl-4-ethenylsulfinyloxybutane-1-sulfonate |
| SMILES | C=COS(=O)C(CCCS(=O)(=O)[O-])OS(=O)C=C.[Na+] |
| InChI | InChI=1S/C8H14O7S3.Na/c1-3-14-17(10)8(15-16(9)4-2)6-5-7-18(11,12)13;/h3-4,8H,1-2,5-7H2,(H,11,12,13);/q;+1/p-1 |
| InChIKey | DAKOCIWAXWTZNV-UHFFFAOYSA-M |
| XLogP | -2.71 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | -2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|