About 2-prop-2-enylsulfonyloxyethenyl prop-2-ene-1-sulfonate
2-prop-2-enylsulfonyloxyethenyl prop-2-ene-1-sulfonate (PubChem CID 123696788) has the molecular formula C8H12O6S2
and a molecular weight of 268.31 g/mol. Its IUPAC name is 2-prop-2-enylsulfonyloxyethenyl prop-2-ene-1-sulfonate.
Molecular Properties
| Compound Name | 2-prop-2-enylsulfonyloxyethenyl prop-2-ene-1-sulfonate |
| PubChem CID | 123696788 |
| Molecular Formula | C8H12O6S2 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | 2-prop-2-enylsulfonyloxyethenyl prop-2-ene-1-sulfonate |
| SMILES | C=CCS(=O)(=O)OC=COS(=O)(=O)CC=C |
| InChI | InChI=1S/C8H12O6S2/c1-3-7-15(9,10)13-5-6-14-16(11,12)8-4-2/h3-6H,1-2,7-8H2 |
| InChIKey | JIQGXCLXIMGIID-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-2-enylsulfonyloxyethenyl prop-2-ene-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-2-enylsulfonyloxyethenyl prop-2-ene-1-sulfonate?
The IUPAC name of 2-prop-2-enylsulfonyloxyethenyl prop-2-ene-1-sulfonate (CID 123696788) is 2-prop-2-enylsulfonyloxyethenyl prop-2-ene-1-sulfonate.
What is the SMILES notation for 2-prop-2-enylsulfonyloxyethenyl prop-2-ene-1-sulfonate?
The canonical SMILES for 2-prop-2-enylsulfonyloxyethenyl prop-2-ene-1-sulfonate is C=CCS(=O)(=O)OC=COS(=O)(=O)CC=C.
What is the InChIKey of 2-prop-2-enylsulfonyloxyethenyl prop-2-ene-1-sulfonate?
The InChIKey is JIQGXCLXIMGIID-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O6S2/c1-3-7-15(9,10)13-5-6-14-16(11,12)8-4-2/h3-6H,1-2,7-8H2.
What are the key properties of 2-prop-2-enylsulfonyloxyethenyl prop-2-ene-1-sulfonate?
2-prop-2-enylsulfonyloxyethenyl prop-2-ene-1-sulfonate has a molecular weight of 268.31 g/mol, XLogP of 0.52, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-2-enylsulfonyloxyethenyl prop-2-ene-1-sulfonate is sourced from PubChem (CID 123696788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).