C20H30O2 — CID 59966993
CID 59966993 (PubChem CID 59966993) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol.
| Compound Name | CID 59966993 |
|---|---|
| PubChem CID | 59966993 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | — |
| SMILES | [CH]C1CC([CH])C(C(=O)OC2(CC)C3(C)CCC(C3)C2(C)C)C1 |
| InChI | InChI=1S/C20H30O2/c1-7-20(18(4,5)15-8-9-19(20,6)12-15)22-17(21)16-11-13(2)10-14(16)3/h2-3,13-16H,7-12H2,1,4-6H3 |
| InChIKey | SYOYUVRFDBTFTC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |