C27H40O7 — CID 59969494
(8-ethyl-8-tricyclo[5.2.1.02,6]decanyl) 2-[4-(6-ethoxy-3-methyloxan-2-yl)-2,5-dioxooxolan-3-yl]propanoate (PubChem CID 59969494) has the molecular formula C27H40O7 and a molecular weight of 476.61 g/mol. Its IUPAC name is (8-ethyl-8-tricyclo[5.2.1.02,6]decanyl) 2-[4-(6-ethoxy-3-methyloxan-2-yl)-2,5-dioxooxolan-3-yl]propanoate.
| Compound Name | (8-ethyl-8-tricyclo[5.2.1.02,6]decanyl) 2-[4-(6-ethoxy-3-methyloxan-2-yl)-2,5-dioxooxolan-3-yl]propanoate |
|---|---|
| PubChem CID | 59969494 |
| Molecular Formula | C27H40O7 |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | (8-ethyl-8-tricyclo[5.2.1.02,6]decanyl) 2-[4-(6-ethoxy-3-methyloxan-2-yl)-2,5-dioxooxolan-3-yl]propanoate |
| SMILES | CCOC1CCC(C)C(C2C(=O)OC(=O)C2C(C)C(=O)OC2(CC)CC3CC2C2CCCC32)O1 |
| InChI | InChI=1S/C27H40O7/c1-5-27(13-16-12-19(27)18-9-7-8-17(16)18)34-24(28)15(4)21-22(26(30)33-25(21)29)23-14(3)10-11-20(32-23)31-6-2/h14-23H,5-13H2,1-4H3 |
| InChIKey | IAJYTJBFGFFIMY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|