C18H22N2O3 — CID 59971131
(1S,2R,6S,8S)-5-hydroxy-8,10-dimethyl-4-(4-methylphenyl)-7-oxa-4,12-diazatricyclo[6.4.0.02,6]dodec-9-en-3-one (PubChem CID 59971131) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is (1S,2R,6S,8S)-5-hydroxy-8,10-dimethyl-4-(4-methylphenyl)-7-oxa-4,12-diazatricyclo[6.4.0.02,6]dodec-9-en-3-one.
| Compound Name | (1S,2R,6S,8S)-5-hydroxy-8,10-dimethyl-4-(4-methylphenyl)-7-oxa-4,12-diazatricyclo[6.4.0.02,6]dodec-9-en-3-one |
|---|---|
| PubChem CID | 59971131 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | (1S,2R,6S,8S)-5-hydroxy-8,10-dimethyl-4-(4-methylphenyl)-7-oxa-4,12-diazatricyclo[6.4.0.02,6]dodec-9-en-3-one |
| SMILES | CC1=C[C@]2(C)O[C@@H]3C(O)N(c4ccc(C)cc4)C(=O)[C@@H]3[C@@H]2NC1 |
| InChI | InChI=1S/C18H22N2O3/c1-10-4-6-12(7-5-10)20-16(21)13-14(17(20)22)23-18(3)8-11(2)9-19-15(13)18/h4-8,13-15,17,19,22H,9H2,1-3H3/t13-,14-,15-,17?,18-/m0/s1 |
| InChIKey | ZTGUKXAPDJZRFH-KBIAFSSCSA-N |
| XLogP | 1.35 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|