C12H18N2O3 — CID 59971127
(1S,2R,5S,6S,8S)-5-hydroxy-4,8,10-trimethyl-7-oxa-4,12-diazatricyclo[6.4.0.02,6]dodec-9-en-3-one (PubChem CID 59971127) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is (1S,2R,5S,6S,8S)-5-hydroxy-4,8,10-trimethyl-7-oxa-4,12-diazatricyclo[6.4.0.02,6]dodec-9-en-3-one.
| Compound Name | (1S,2R,5S,6S,8S)-5-hydroxy-4,8,10-trimethyl-7-oxa-4,12-diazatricyclo[6.4.0.02,6]dodec-9-en-3-one |
|---|---|
| PubChem CID | 59971127 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | (1S,2R,5S,6S,8S)-5-hydroxy-4,8,10-trimethyl-7-oxa-4,12-diazatricyclo[6.4.0.02,6]dodec-9-en-3-one |
| SMILES | CC1=C[C@]2(C)O[C@H]3[C@H](C(=O)N(C)[C@H]3O)[C@@H]2NC1 |
| InChI | InChI=1S/C12H18N2O3/c1-6-4-12(2)9(13-5-6)7-8(17-12)11(16)14(3)10(7)15/h4,7-9,11,13,16H,5H2,1-3H3/t7-,8-,9-,11-,12-/m0/s1 |
| InChIKey | VMBPYBYFXUFVGS-UXGSPEMBSA-N |
| XLogP | -0.53 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|