C14H18N2O5 — CID 159573997
4,8,10,11-tetramethyl-3,5-dioxo-7-oxa-4,12-diazatricyclo[6.4.0.02,6]dodec-9-ene-12-carboxylic acid (PubChem CID 159573997) has the molecular formula C14H18N2O5 and a molecular weight of 294.31 g/mol. Its IUPAC name is 4,8,10,11-tetramethyl-3,5-dioxo-7-oxa-4,12-diazatricyclo[6.4.0.02,6]dodec-9-ene-12-carboxylic acid.
| Compound Name | 4,8,10,11-tetramethyl-3,5-dioxo-7-oxa-4,12-diazatricyclo[6.4.0.02,6]dodec-9-ene-12-carboxylic acid |
|---|---|
| PubChem CID | 159573997 |
| Molecular Formula | C14H18N2O5 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 4,8,10,11-tetramethyl-3,5-dioxo-7-oxa-4,12-diazatricyclo[6.4.0.02,6]dodec-9-ene-12-carboxylic acid |
| SMILES | CC1=CC2(C)OC3C(=O)N(C)C(=O)C3C2N(C(=O)O)C1C |
| InChI | InChI=1S/C14H18N2O5/c1-6-5-14(3)10(16(7(6)2)13(19)20)8-9(21-14)12(18)15(4)11(8)17/h5,7-10H,1-4H3,(H,19,20) |
| InChIKey | BQULSIABBAJYPG-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|