C14H19IN2O3 — CID 160615355
(1S,2R,6S,8S)-4-ethyl-8,10,12-trimethyl-7-oxa-4-aza-12-azoniatricyclo[6.4.0.02,6]dodeca-9,11-diene-3,5-dione iodide (PubChem CID 160615355) has the molecular formula C14H19IN2O3 and a molecular weight of 390.22 g/mol. Its IUPAC name is (1S,2R,6S,8S)-4-ethyl-8,10,12-trimethyl-7-oxa-4-aza-12-azoniatricyclo[6.4.0.02,6]dodeca-9,11-diene-3,5-dione iodide.
| Compound Name | (1S,2R,6S,8S)-4-ethyl-8,10,12-trimethyl-7-oxa-4-aza-12-azoniatricyclo[6.4.0.02,6]dodeca-9,11-diene-3,5-dione iodide |
|---|---|
| PubChem CID | 160615355 |
| Molecular Formula | C14H19IN2O3 |
| Molecular Weight | 390.22 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | (1S,2R,6S,8S)-4-ethyl-8,10,12-trimethyl-7-oxa-4-aza-12-azoniatricyclo[6.4.0.02,6]dodeca-9,11-diene-3,5-dione iodide |
| SMILES | CCN1C(=O)[C@H]2[C@H](O[C@@]3(C)C=C(C)C=[N+](C)[C@@H]23)C1=O.[I-] |
| InChI | InChI=1S/C14H19N2O3.HI/c1-5-16-12(17)9-10(13(16)18)19-14(3)6-8(2)7-15(4)11(9)14;/h6-7,9-11H,5H2,1-4H3;1H/q+1;/p-1/t9-,10-,11-,14-;/m0./s1 |
| InChIKey | ZVPKIGZWZMBTLG-KSVZSFFDSA-M |
| XLogP | -2.81 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.22 |
| LogP ≤ 5 | -2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|