C15H18N2O5 — CID 59968364
ethynyl (1S,2R,6S,8S,10S)-4,8,10-trimethyl-3,5-dioxo-7-oxa-4,12-diazatricyclo[6.4.0.02,6]dodecane-12-carboxylate (PubChem CID 59968364) has the molecular formula C15H18N2O5 and a molecular weight of 306.32 g/mol. Its IUPAC name is ethynyl (1S,2R,6S,8S,10S)-4,8,10-trimethyl-3,5-dioxo-7-oxa-4,12-diazatricyclo[6.4.0.02,6]dodecane-12-carboxylate.
| Compound Name | ethynyl (1S,2R,6S,8S,10S)-4,8,10-trimethyl-3,5-dioxo-7-oxa-4,12-diazatricyclo[6.4.0.02,6]dodecane-12-carboxylate |
|---|---|
| PubChem CID | 59968364 |
| Molecular Formula | C15H18N2O5 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | ethynyl (1S,2R,6S,8S,10S)-4,8,10-trimethyl-3,5-dioxo-7-oxa-4,12-diazatricyclo[6.4.0.02,6]dodecane-12-carboxylate |
| SMILES | C#COC(=O)N1C[C@@H](C)C[C@]2(C)O[C@@H]3C(=O)N(C)C(=O)[C@@H]3[C@H]12 |
| InChI | InChI=1S/C15H18N2O5/c1-5-21-14(20)17-7-8(2)6-15(3)11(17)9-10(22-15)13(19)16(4)12(9)18/h1,8-11H,6-7H2,2-4H3/t8-,9-,10-,11-,15-/m0/s1 |
| InChIKey | WMDXZRITYOHSCF-DMZJWBPISA-N |
| XLogP | 0.20 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|