C15H18Cl3N3O5 — CID 54233767
(1S,8S,10S)-3,5-dihydroxy-4,8,10-trimethyl-N-(2,2,2-trichloroacetyl)-7-oxa-4,12-diazatricyclo[6.4.0.02,6]dodeca-2,5-diene-12-carboxamide (PubChem CID 54233767) has the molecular formula C15H18Cl3N3O5 and a molecular weight of 426.68 g/mol. Its IUPAC name is (1S,8S,10S)-3,5-dihydroxy-4,8,10-trimethyl-N-(2,2,2-trichloroacetyl)-7-oxa-4,12-diazatricyclo[6.4.0.02,6]dodeca-2,5-diene-12-carboxamide.
| Compound Name | (1S,8S,10S)-3,5-dihydroxy-4,8,10-trimethyl-N-(2,2,2-trichloroacetyl)-7-oxa-4,12-diazatricyclo[6.4.0.02,6]dodeca-2,5-diene-12-carboxamide |
|---|---|
| PubChem CID | 54233767 |
| Molecular Formula | C15H18Cl3N3O5 |
| Molecular Weight | 426.68 g/mol |
| Exact Mass | 425.03 |
| IUPAC Name | (1S,8S,10S)-3,5-dihydroxy-4,8,10-trimethyl-N-(2,2,2-trichloroacetyl)-7-oxa-4,12-diazatricyclo[6.4.0.02,6]dodeca-2,5-diene-12-carboxamide |
| SMILES | C[C@@H]1CN(C(=O)NC(=O)C(Cl)(Cl)Cl)[C@H]2c3c(c(O)n(C)c3O)O[C@@]2(C)C1 |
| InChI | InChI=1S/C15H18Cl3N3O5/c1-6-4-14(2)9(7-8(26-14)11(23)20(3)10(7)22)21(5-6)13(25)19-12(24)15(16,17)18/h6,9,22-23H,4-5H2,1-3H3,(H,19,24,25)/t6-,9-,14-/m0/s1 |
| InChIKey | QLCCPHFEFDRXSB-WGIXKALHSA-N |
| XLogP | 2.58 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.68 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|