C20H37N3O3 — CID 177498131
CID 177498131 (PubChem CID 177498131) has the molecular formula C20H37N3O3 and a molecular weight of 367.53 g/mol.
| Compound Name | CID 177498131 |
|---|---|
| PubChem CID | 177498131 |
| Molecular Formula | C20H37N3O3 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.28 |
| IUPAC Name | — |
| SMILES | CC(=O)N(C1CC(C)(C)N([O])C(C)(C)C1)C1CC(C)(C)N([O])C(C)(C)C1 |
| InChI | InChI=1S/C20H37N3O3/c1-14(24)21(15-10-17(2,3)22(25)18(4,5)11-15)16-12-19(6,7)23(26)20(8,9)13-16/h15-16H,10-13H2,1-9H3 |
| InChIKey | SAHLWUYBVYHMCO-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 66.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |