C26H50N4O2 — CID 20670995
N,N'-dimethyl-N,N'-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)butanediamide (PubChem CID 20670995) has the molecular formula C26H50N4O2 and a molecular weight of 450.71 g/mol. Its IUPAC name is N,N'-dimethyl-N,N'-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)butanediamide.
| Compound Name | N,N'-dimethyl-N,N'-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)butanediamide |
|---|---|
| PubChem CID | 20670995 |
| Molecular Formula | C26H50N4O2 |
| Molecular Weight | 450.71 g/mol |
| Exact Mass | 450.39 |
| IUPAC Name | N,N'-dimethyl-N,N'-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)butanediamide |
| SMILES | CN(C(=O)CCC(=O)N(C)C1CC(C)(C)N(C)C(C)(C)C1)C1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C26H50N4O2/c1-23(2)15-19(16-24(3,4)29(23)11)27(9)21(31)13-14-22(32)28(10)20-17-25(5,6)30(12)26(7,8)18-20/h19-20H,13-18H2,1-12H3 |
| InChIKey | JBHWBGDVPHPFCA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.71 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |