C26H48N4O4 — CID 170839064
N-[6-[formyl-(2,2,6,6-tetramethyl-1-oxopiperidin-1-ium-4-yl)amino]hexyl]-N-(2,2,6,6-tetramethyl-1-oxidopiperidin-4-yl)formamide (PubChem CID 170839064) has the molecular formula C26H48N4O4 and a molecular weight of 480.69 g/mol. Its IUPAC name is N-[6-[formyl-(2,2,6,6-tetramethyl-1-oxopiperidin-1-ium-4-yl)amino]hexyl]-N-(2,2,6,6-tetramethyl-1-oxidopiperidin-4-yl)formamide.
| Compound Name | N-[6-[formyl-(2,2,6,6-tetramethyl-1-oxopiperidin-1-ium-4-yl)amino]hexyl]-N-(2,2,6,6-tetramethyl-1-oxidopiperidin-4-yl)formamide |
|---|---|
| PubChem CID | 170839064 |
| Molecular Formula | C26H48N4O4 |
| Molecular Weight | 480.69 g/mol |
| Exact Mass | 480.37 |
| IUPAC Name | N-[6-[formyl-(2,2,6,6-tetramethyl-1-oxopiperidin-1-ium-4-yl)amino]hexyl]-N-(2,2,6,6-tetramethyl-1-oxidopiperidin-4-yl)formamide |
| SMILES | CC1(C)CC(N(C=O)CCCCCCN(C=O)C2CC(C)(C)[N+](=O)C(C)(C)C2)CC(C)(C)N1[O-] |
| InChI | InChI=1S/C26H48N4O4/c1-23(2)15-21(16-24(3,4)29(23)33)27(19-31)13-11-9-10-12-14-28(20-32)22-17-25(5,6)30(34)26(7,8)18-22/h19-22H,9-18H2,1-8H3 |
| InChIKey | ULHALNOQUAOLTI-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 87.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.69 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|