C32H62N4O4 — CID 23450615
N-[6-[formyl-(2,2,6,6-tetramethyl-1-propoxypiperidin-4-yl)amino]hexyl]-N-(2,2,6,6-tetramethyl-1-propoxypiperidin-4-yl)formamide (PubChem CID 23450615) has the molecular formula C32H62N4O4 and a molecular weight of 566.87 g/mol. Its IUPAC name is N-[6-[formyl-(2,2,6,6-tetramethyl-1-propoxypiperidin-4-yl)amino]hexyl]-N-(2,2,6,6-tetramethyl-1-propoxypiperidin-4-yl)formamide.
| Compound Name | N-[6-[formyl-(2,2,6,6-tetramethyl-1-propoxypiperidin-4-yl)amino]hexyl]-N-(2,2,6,6-tetramethyl-1-propoxypiperidin-4-yl)formamide |
|---|---|
| PubChem CID | 23450615 |
| Molecular Formula | C32H62N4O4 |
| Molecular Weight | 566.87 g/mol |
| Exact Mass | 566.48 |
| IUPAC Name | N-[6-[formyl-(2,2,6,6-tetramethyl-1-propoxypiperidin-4-yl)amino]hexyl]-N-(2,2,6,6-tetramethyl-1-propoxypiperidin-4-yl)formamide |
| SMILES | CCCON1C(C)(C)CC(N(C=O)CCCCCCN(C=O)C2CC(C)(C)N(OCCC)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C32H62N4O4/c1-11-19-39-35-29(3,4)21-27(22-30(35,5)6)33(25-37)17-15-13-14-16-18-34(26-38)28-23-31(7,8)36(40-20-12-2)32(9,10)24-28/h25-28H,11-24H2,1-10H3 |
| InChIKey | RHNAGBDIJJAGIP-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 65.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.87 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|