C12H16Cl3NO5 — CID 139090185
methyl (3aR,4S,6R,6aS)-2,2-dimethyl-4-[(2,2,2-trichloroacetyl)amino]-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-6-carboxylate (PubChem CID 139090185) has the molecular formula C12H16Cl3NO5 and a molecular weight of 360.62 g/mol. Its IUPAC name is methyl (3aR,4S,6R,6aS)-2,2-dimethyl-4-[(2,2,2-trichloroacetyl)amino]-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-6-carboxylate.
| Compound Name | methyl (3aR,4S,6R,6aS)-2,2-dimethyl-4-[(2,2,2-trichloroacetyl)amino]-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-6-carboxylate |
|---|---|
| PubChem CID | 139090185 |
| Molecular Formula | C12H16Cl3NO5 |
| Molecular Weight | 360.62 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | methyl (3aR,4S,6R,6aS)-2,2-dimethyl-4-[(2,2,2-trichloroacetyl)amino]-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-6-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](NC(=O)C(Cl)(Cl)Cl)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C12H16Cl3NO5/c1-11(2)20-7-5(9(17)19-3)4-6(8(7)21-11)16-10(18)12(13,14)15/h5-8H,4H2,1-3H3,(H,16,18)/t5-,6+,7+,8-/m1/s1 |
| InChIKey | ACCVDGZJTYIKAJ-VGRMVHKJSA-N |
| XLogP | 1.55 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.62 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|