C13H16Cl3NO3 — CID 135028157
methyl (3R,3aS,4S)-3-[(2,2,2-trichloroacetyl)amino]-2,3,3a,4,5,6-hexahydro-1H-indene-4-carboxylate (PubChem CID 135028157) has the molecular formula C13H16Cl3NO3 and a molecular weight of 340.63 g/mol. Its IUPAC name is methyl (3R,3aS,4S)-3-[(2,2,2-trichloroacetyl)amino]-2,3,3a,4,5,6-hexahydro-1H-indene-4-carboxylate.
| Compound Name | methyl (3R,3aS,4S)-3-[(2,2,2-trichloroacetyl)amino]-2,3,3a,4,5,6-hexahydro-1H-indene-4-carboxylate |
|---|---|
| PubChem CID | 135028157 |
| Molecular Formula | C13H16Cl3NO3 |
| Molecular Weight | 340.63 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | methyl (3R,3aS,4S)-3-[(2,2,2-trichloroacetyl)amino]-2,3,3a,4,5,6-hexahydro-1H-indene-4-carboxylate |
| SMILES | COC(=O)[C@H]1CCC=C2CC[C@@H](NC(=O)C(Cl)(Cl)Cl)[C@H]21 |
| InChI | InChI=1S/C13H16Cl3NO3/c1-20-11(18)8-4-2-3-7-5-6-9(10(7)8)17-12(19)13(14,15)16/h3,8-10H,2,4-6H2,1H3,(H,17,19)/t8-,9+,10+/m0/s1 |
| InChIKey | LOXVRSAZZMIBLB-IVZWLZJFSA-N |
| XLogP | 2.76 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.63 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|