C7H10Cl3NO3 — CID 101055873
2,2,2-trichloro-N-[(1R,2S,3R)-2,3-dihydroxycyclopentyl]acetamide (PubChem CID 101055873) has the molecular formula C7H10Cl3NO3 and a molecular weight of 262.52 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[(1R,2S,3R)-2,3-dihydroxycyclopentyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[(1R,2S,3R)-2,3-dihydroxycyclopentyl]acetamide |
|---|---|
| PubChem CID | 101055873 |
| Molecular Formula | C7H10Cl3NO3 |
| Molecular Weight | 262.52 g/mol |
| Exact Mass | 260.97 |
| IUPAC Name | 2,2,2-trichloro-N-[(1R,2S,3R)-2,3-dihydroxycyclopentyl]acetamide |
| SMILES | O=C(N[C@@H]1CC[C@@H](O)[C@H]1O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C7H10Cl3NO3/c8-7(9,10)6(14)11-3-1-2-4(12)5(3)13/h3-5,12-13H,1-2H2,(H,11,14)/t3-,4-,5+/m1/s1 |
| InChIKey | NJFYVFSIVDARHW-WDCZJNDASA-N |
| XLogP | 0.36 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.52 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|