C12H18Cl3NO3 — CID 139250012
ethyl 2-ethyl-5-[(2,2,2-trichloroacetyl)amino]cyclopentane-1-carboxylate (PubChem CID 139250012) has the molecular formula C12H18Cl3NO3 and a molecular weight of 330.64 g/mol. Its IUPAC name is ethyl 2-ethyl-5-[(2,2,2-trichloroacetyl)amino]cyclopentane-1-carboxylate.
| Compound Name | ethyl 2-ethyl-5-[(2,2,2-trichloroacetyl)amino]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 139250012 |
| Molecular Formula | C12H18Cl3NO3 |
| Molecular Weight | 330.64 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | ethyl 2-ethyl-5-[(2,2,2-trichloroacetyl)amino]cyclopentane-1-carboxylate |
| SMILES | CCOC(=O)C1C(CC)CCC1NC(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H18Cl3NO3/c1-3-7-5-6-8(9(7)10(17)19-4-2)16-11(18)12(13,14)15/h7-9H,3-6H2,1-2H3,(H,16,18) |
| InChIKey | JWDSTPSDXWHDPD-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.64 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|