C11H16F5NO — CID 114038212
N-(3-ethyl-2-methylcyclopentyl)-2,2,3,3,3-pentafluoropropanamide (PubChem CID 114038212) has the molecular formula C11H16F5NO and a molecular weight of 273.25 g/mol. Its IUPAC name is N-(3-ethyl-2-methylcyclopentyl)-2,2,3,3,3-pentafluoropropanamide.
| Compound Name | N-(3-ethyl-2-methylcyclopentyl)-2,2,3,3,3-pentafluoropropanamide |
|---|---|
| PubChem CID | 114038212 |
| Molecular Formula | C11H16F5NO |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | N-(3-ethyl-2-methylcyclopentyl)-2,2,3,3,3-pentafluoropropanamide |
| SMILES | CCC1CCC(NC(=O)C(F)(F)C(F)(F)F)C1C |
| InChI | InChI=1S/C11H16F5NO/c1-3-7-4-5-8(6(7)2)17-9(18)10(12,13)11(14,15)16/h6-8H,3-5H2,1-2H3,(H,17,18) |
| InChIKey | LTPYIYLDUIMFAR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|