C12H23NO2 — CID 116656380
propan-2-yl N-(3-ethyl-2-methylcyclopentyl)carbamate (PubChem CID 116656380) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is propan-2-yl N-(3-ethyl-2-methylcyclopentyl)carbamate.
| Compound Name | propan-2-yl N-(3-ethyl-2-methylcyclopentyl)carbamate |
|---|---|
| PubChem CID | 116656380 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | propan-2-yl N-(3-ethyl-2-methylcyclopentyl)carbamate |
| SMILES | CCC1CCC(NC(=O)OC(C)C)C1C |
| InChI | InChI=1S/C12H23NO2/c1-5-10-6-7-11(9(10)4)13-12(14)15-8(2)3/h8-11H,5-7H2,1-4H3,(H,13,14) |
| InChIKey | KAYYRJXDJXQHFQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |