C11H21NOS — CID 107031086
N-(3-ethyl-2-methylcyclopentyl)-2-sulfanylpropanamide (PubChem CID 107031086) has the molecular formula C11H21NOS and a molecular weight of 215.36 g/mol. Its IUPAC name is N-(3-ethyl-2-methylcyclopentyl)-2-sulfanylpropanamide.
| Compound Name | N-(3-ethyl-2-methylcyclopentyl)-2-sulfanylpropanamide |
|---|---|
| PubChem CID | 107031086 |
| Molecular Formula | C11H21NOS |
| Molecular Weight | 215.36 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | N-(3-ethyl-2-methylcyclopentyl)-2-sulfanylpropanamide |
| SMILES | CCC1CCC(NC(=O)C(C)S)C1C |
| InChI | InChI=1S/C11H21NOS/c1-4-9-5-6-10(7(9)2)12-11(13)8(3)14/h7-10,14H,4-6H2,1-3H3,(H,12,13) |
| InChIKey | DFMVTEYJGIQOQT-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|