C10H13N3O3 — CID 110125140
N-[(1R,2R,3R)-2,3-dihydroxycyclopentyl]pyrimidine-4-carboxamide (PubChem CID 110125140) has the molecular formula C10H13N3O3 and a molecular weight of 223.23 g/mol. Its IUPAC name is N-[(1R,2R,3R)-2,3-dihydroxycyclopentyl]pyrimidine-4-carboxamide.
| Compound Name | N-[(1R,2R,3R)-2,3-dihydroxycyclopentyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 110125140 |
| Molecular Formula | C10H13N3O3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | N-[(1R,2R,3R)-2,3-dihydroxycyclopentyl]pyrimidine-4-carboxamide |
| SMILES | O=C(N[C@@H]1CC[C@@H](O)[C@@H]1O)c1ccncn1 |
| InChI | InChI=1S/C10H13N3O3/c14-8-2-1-6(9(8)15)13-10(16)7-3-4-11-5-12-7/h3-6,8-9,14-15H,1-2H2,(H,13,16)/t6-,8-,9-/m1/s1 |
| InChIKey | RERCWLAKZYXASI-FTLITQJKSA-N |
| XLogP | -0.91 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |