C7H10O2S — CID 13152938
methyl 3-methyl-2,5-dihydrothiophene-2-carboxylate (PubChem CID 13152938) has the molecular formula C7H10O2S and a molecular weight of 158.22 g/mol. Its IUPAC name is methyl 3-methyl-2,5-dihydrothiophene-2-carboxylate.
| Compound Name | methyl 3-methyl-2,5-dihydrothiophene-2-carboxylate |
|---|---|
| PubChem CID | 13152938 |
| Molecular Formula | C7H10O2S |
| Molecular Weight | 158.22 g/mol |
| Exact Mass | 158.04 |
| IUPAC Name | methyl 3-methyl-2,5-dihydrothiophene-2-carboxylate |
| SMILES | COC(=O)C1SCC=C1C |
| InChI | InChI=1S/C7H10O2S/c1-5-3-4-10-6(5)7(8)9-2/h3,6H,4H2,1-2H3 |
| InChIKey | ZWFHUYPRCNAUQU-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.22 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|