C14H16N2O6 — CID 10518852
methyl (1R,2R,6S,7S,11S)-4,11-dimethyl-3,5,8-trioxo-13-oxa-4,9-diazatetracyclo[5.5.1.01,9.02,6]tridecane-7-carboxylate (PubChem CID 10518852) has the molecular formula C14H16N2O6 and a molecular weight of 308.29 g/mol. Its IUPAC name is methyl (1R,2R,6S,7S,11S)-4,11-dimethyl-3,5,8-trioxo-13-oxa-4,9-diazatetracyclo[5.5.1.01,9.02,6]tridecane-7-carboxylate.
| Compound Name | methyl (1R,2R,6S,7S,11S)-4,11-dimethyl-3,5,8-trioxo-13-oxa-4,9-diazatetracyclo[5.5.1.01,9.02,6]tridecane-7-carboxylate |
|---|---|
| PubChem CID | 10518852 |
| Molecular Formula | C14H16N2O6 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | methyl (1R,2R,6S,7S,11S)-4,11-dimethyl-3,5,8-trioxo-13-oxa-4,9-diazatetracyclo[5.5.1.01,9.02,6]tridecane-7-carboxylate |
| SMILES | COC(=O)[C@@]12O[C@]3(C[C@H](C)CN3C1=O)[C@@H]1C(=O)N(C)C(=O)[C@@H]12 |
| InChI | InChI=1S/C14H16N2O6/c1-6-4-13-7-8(10(18)15(2)9(7)17)14(22-13,12(20)21-3)11(19)16(13)5-6/h6-8H,4-5H2,1-3H3/t6-,7-,8+,13+,14-/m0/s1 |
| InChIKey | FTHOBCBMUDGQEZ-BHAIIGLKSA-N |
| XLogP | -1.26 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|