C22H24N2O8 — CID 102121838
ethyl (1S,2S,6R,7R)-8-[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]-4,7-dimethyl-3,5,9-trioxo-10-oxa-4,8-diazatricyclo[5.2.1.02,6]decane-1-carboxylate (PubChem CID 102121838) has the molecular formula C22H24N2O8 and a molecular weight of 444.44 g/mol. Its IUPAC name is ethyl (1S,2S,6R,7R)-8-[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]-4,7-dimethyl-3,5,9-trioxo-10-oxa-4,8-diazatricyclo[5.2.1.02,6]decane-1-carboxylate.
| Compound Name | ethyl (1S,2S,6R,7R)-8-[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]-4,7-dimethyl-3,5,9-trioxo-10-oxa-4,8-diazatricyclo[5.2.1.02,6]decane-1-carboxylate |
|---|---|
| PubChem CID | 102121838 |
| Molecular Formula | C22H24N2O8 |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | ethyl (1S,2S,6R,7R)-8-[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]-4,7-dimethyl-3,5,9-trioxo-10-oxa-4,8-diazatricyclo[5.2.1.02,6]decane-1-carboxylate |
| SMILES | CCOC(=O)[C@]12O[C@](C)([C@@H]3C(=O)N(C)C(=O)[C@@H]31)N([C@@H](Cc1ccccc1)C(=O)OC)C2=O |
| InChI | InChI=1S/C22H24N2O8/c1-5-31-20(29)22-15-14(16(25)23(3)17(15)26)21(2,32-22)24(19(22)28)13(18(27)30-4)11-12-9-7-6-8-10-12/h6-10,13-15H,5,11H2,1-4H3/t13-,14-,15+,21+,22-/m0/s1 |
| InChIKey | HPPPYCIDJGJASS-BXYJZGPVSA-N |
| XLogP | -0.11 |
| TPSA | 119.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|