C18H21NO4 — CID 15358912
methyl 2-[(3R,4R)-3-acetyl-2-oxo-4-prop-1-en-2-ylazetidin-1-yl]-3-phenylpropanoate (PubChem CID 15358912) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is methyl 2-[(3R,4R)-3-acetyl-2-oxo-4-prop-1-en-2-ylazetidin-1-yl]-3-phenylpropanoate.
| Compound Name | methyl 2-[(3R,4R)-3-acetyl-2-oxo-4-prop-1-en-2-ylazetidin-1-yl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 15358912 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | methyl 2-[(3R,4R)-3-acetyl-2-oxo-4-prop-1-en-2-ylazetidin-1-yl]-3-phenylpropanoate |
| SMILES | C=C(C)[C@H]1[C@H](C(C)=O)C(=O)N1C(Cc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C18H21NO4/c1-11(2)16-15(12(3)20)17(21)19(16)14(18(22)23-4)10-13-8-6-5-7-9-13/h5-9,14-16H,1,10H2,2-4H3/t14?,15-,16-/m0/s1 |
| InChIKey | QFFDGFKADXIDOP-YVZMLIKISA-N |
| XLogP | 1.76 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|