C27H23NO4 — CID 110193794
methyl (2S)-2-(3-acetyl-4-oxospiro[azetidine-2,9'-fluorene]-1-yl)-3-phenylpropanoate (PubChem CID 110193794) has the molecular formula C27H23NO4 and a molecular weight of 425.48 g/mol. Its IUPAC name is methyl (2S)-2-(3-acetyl-4-oxospiro[azetidine-2,9'-fluorene]-1-yl)-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-(3-acetyl-4-oxospiro[azetidine-2,9'-fluorene]-1-yl)-3-phenylpropanoate |
|---|---|
| PubChem CID | 110193794 |
| Molecular Formula | C27H23NO4 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | methyl (2S)-2-(3-acetyl-4-oxospiro[azetidine-2,9'-fluorene]-1-yl)-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)N1C(=O)C(C(C)=O)C12c1ccccc1-c1ccccc12 |
| InChI | InChI=1S/C27H23NO4/c1-17(29)24-25(30)28(23(26(31)32-2)16-18-10-4-3-5-11-18)27(24)21-14-8-6-12-19(21)20-13-7-9-15-22(20)27/h3-15,23-24H,16H2,1-2H3/t23-,24?/m0/s1 |
| InChIKey | IDZFEQYHZRGNOM-UXMRNZNESA-N |
| XLogP | 3.74 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|