C27H26N2O3 — CID 177481762
methyl 2-(4,4-dibenzyl-5-oxoimidazol-1-yl)-3-phenylpropanoate (PubChem CID 177481762) has the molecular formula C27H26N2O3 and a molecular weight of 426.52 g/mol. Its IUPAC name is methyl 2-(4,4-dibenzyl-5-oxoimidazol-1-yl)-3-phenylpropanoate.
| Compound Name | methyl 2-(4,4-dibenzyl-5-oxoimidazol-1-yl)-3-phenylpropanoate |
|---|---|
| PubChem CID | 177481762 |
| Molecular Formula | C27H26N2O3 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | methyl 2-(4,4-dibenzyl-5-oxoimidazol-1-yl)-3-phenylpropanoate |
| SMILES | COC(=O)C(Cc1ccccc1)N1C=NC(Cc2ccccc2)(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C27H26N2O3/c1-32-25(30)24(17-21-11-5-2-6-12-21)29-20-28-27(26(29)31,18-22-13-7-3-8-14-22)19-23-15-9-4-10-16-23/h2-16,20,24H,17-19H2,1H3 |
| InChIKey | SGXOPTJGUOLXBE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |