C30H33NO7 — CID 139254363
diethyl (1R,9S,11R)-15-[(2R)-1-methoxy-1-oxo-3-phenylpropan-2-yl]-2-oxo-15-azatetracyclo[7.5.1.01,11.03,8]pentadeca-3,5,7-triene-13,13-dicarboxylate (PubChem CID 139254363) has the molecular formula C30H33NO7 and a molecular weight of 519.59 g/mol. Its IUPAC name is diethyl (1R,9S,11R)-15-[(2R)-1-methoxy-1-oxo-3-phenylpropan-2-yl]-2-oxo-15-azatetracyclo[7.5.1.01,11.03,8]pentadeca-3,5,7-triene-13,13-dicarboxylate.
| Compound Name | diethyl (1R,9S,11R)-15-[(2R)-1-methoxy-1-oxo-3-phenylpropan-2-yl]-2-oxo-15-azatetracyclo[7.5.1.01,11.03,8]pentadeca-3,5,7-triene-13,13-dicarboxylate |
|---|---|
| PubChem CID | 139254363 |
| Molecular Formula | C30H33NO7 |
| Molecular Weight | 519.59 g/mol |
| Exact Mass | 519.23 |
| IUPAC Name | diethyl (1R,9S,11R)-15-[(2R)-1-methoxy-1-oxo-3-phenylpropan-2-yl]-2-oxo-15-azatetracyclo[7.5.1.01,11.03,8]pentadeca-3,5,7-triene-13,13-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C[C@@H]2C[C@H]3c4ccccc4C(=O)[C@]2(C1)N3[C@H](Cc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C30H33NO7/c1-4-37-27(34)29(28(35)38-5-2)17-20-16-23-21-13-9-10-14-22(21)25(32)30(20,18-29)31(23)24(26(33)36-3)15-19-11-7-6-8-12-19/h6-14,20,23-24H,4-5,15-18H2,1-3H3/t20-,23-,24+,30+/m0/s1 |
| InChIKey | FOXLQFNZEKWQML-AEPSZFNXSA-N |
| XLogP | 3.68 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.59 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|