C24H25N3O8 — CID 16758910
dimethyl (1S,8S)-2-ethyl-3,11-dimethyl-7,10,12-trioxo-5-phenyl-14-oxa-2,6,11-triazatetracyclo[6.5.1.01,6.09,13]tetradec-3-ene-4,8-dicarboxylate (PubChem CID 16758910) has the molecular formula C24H25N3O8 and a molecular weight of 483.48 g/mol. Its IUPAC name is dimethyl (1S,8S)-2-ethyl-3,11-dimethyl-7,10,12-trioxo-5-phenyl-14-oxa-2,6,11-triazatetracyclo[6.5.1.01,6.09,13]tetradec-3-ene-4,8-dicarboxylate.
| Compound Name | dimethyl (1S,8S)-2-ethyl-3,11-dimethyl-7,10,12-trioxo-5-phenyl-14-oxa-2,6,11-triazatetracyclo[6.5.1.01,6.09,13]tetradec-3-ene-4,8-dicarboxylate |
|---|---|
| PubChem CID | 16758910 |
| Molecular Formula | C24H25N3O8 |
| Molecular Weight | 483.48 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | dimethyl (1S,8S)-2-ethyl-3,11-dimethyl-7,10,12-trioxo-5-phenyl-14-oxa-2,6,11-triazatetracyclo[6.5.1.01,6.09,13]tetradec-3-ene-4,8-dicarboxylate |
| SMILES | CCN1C(C)=C(C(=O)OC)C(c2ccccc2)N2C(=O)[C@@]3(C(=O)OC)O[C@@]12C1C(=O)N(C)C(=O)C13 |
| InChI | InChI=1S/C24H25N3O8/c1-6-26-12(2)14(20(30)33-4)17(13-10-8-7-9-11-13)27-21(31)23(22(32)34-5)15-16(24(26,27)35-23)19(29)25(3)18(15)28/h7-11,15-17H,6H2,1-5H3/t15?,16?,17?,23-,24-/m0/s1 |
| InChIKey | IOHWEINOTIQHHF-XMBXDRSGSA-N |
| XLogP | 0.18 |
| TPSA | 122.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.48 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|