C23H18K2N4O8S2 — CID 59971626
dipotassium;4-[5-methyl-4-[(E,3E)-3-[3-methyl-1-(4-oxidoperoxysulfanylphenyl)-5-oxopyrazol-4-ylidene]prop-1-enyl]-3-oxo-1H-pyrazol-2-yl]benzenesulfonate (PubChem CID 59971626) has the molecular formula C23H18K2N4O8S2 and a molecular weight of 620.75 g/mol. Its IUPAC name is dipotassium;4-[5-methyl-4-[(E,3E)-3-[3-methyl-1-(4-oxidoperoxysulfanylphenyl)-5-oxopyrazol-4-ylidene]prop-1-enyl]-3-oxo-1H-pyrazol-2-yl]benzenesulfonate.
| Compound Name | dipotassium;4-[5-methyl-4-[(E,3E)-3-[3-methyl-1-(4-oxidoperoxysulfanylphenyl)-5-oxopyrazol-4-ylidene]prop-1-enyl]-3-oxo-1H-pyrazol-2-yl]benzenesulfonate |
|---|---|
| PubChem CID | 59971626 |
| Molecular Formula | C23H18K2N4O8S2 |
| Molecular Weight | 620.75 g/mol |
| Exact Mass | 619.98 |
| IUPAC Name | dipotassium;4-[5-methyl-4-[(E,3E)-3-[3-methyl-1-(4-oxidoperoxysulfanylphenyl)-5-oxopyrazol-4-ylidene]prop-1-enyl]-3-oxo-1H-pyrazol-2-yl]benzenesulfonate |
| SMILES | CC1=NN(c2ccc(SOO[O-])cc2)C(=O)/C1=C/C=C/c1c(C)[nH]n(-c2ccc(S(=O)(=O)[O-])cc2)c1=O.[K+].[K+] |
| InChI | InChI=1S/C23H20N4O8S2.2K/c1-14-20(22(28)26(24-14)16-6-10-18(11-7-16)36-35-34-30)4-3-5-21-15(2)25-27(23(21)29)17-8-12-19(13-9-17)37(31,32)33;;/h3-13,25,30H,1-2H3,(H,31,32,33);;/q;2*+1/p-2/b5-3+,20-4+;; |
| InChIKey | WZVKWECMGXWIDW-NEUVTMMISA-L |
| XLogP | -4.02 |
| TPSA | 169.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.75 |
| LogP ≤ 5 | -4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|