C21H36 — CID 59973496
2,3,5,6,8,9,11,12-octamethyltrideca-2,5,8,11-tetraene (PubChem CID 59973496) has the molecular formula C21H36 and a molecular weight of 288.52 g/mol. Its IUPAC name is 2,3,5,6,8,9,11,12-octamethyltrideca-2,5,8,11-tetraene.
| Compound Name | 2,3,5,6,8,9,11,12-octamethyltrideca-2,5,8,11-tetraene |
|---|---|
| PubChem CID | 59973496 |
| Molecular Formula | C21H36 |
| Molecular Weight | 288.52 g/mol |
| Exact Mass | 288.28 |
| IUPAC Name | 2,3,5,6,8,9,11,12-octamethyltrideca-2,5,8,11-tetraene |
| SMILES | CC(C)=C(C)CC(C)=C(C)CC(C)=C(C)CC(C)=C(C)C |
| InChI | InChI=1S/C21H36/c1-14(2)16(5)11-18(7)20(9)13-21(10)19(8)12-17(6)15(3)4/h11-13H2,1-10H3 |
| InChIKey | DMFLKWYJMWDCAV-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.52 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|