C10H13N2OW- — CID 59974001
3-methanidyl-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one;tungsten (PubChem CID 59974001) has the molecular formula C10H13N2OW- and a molecular weight of 361.07 g/mol. Its IUPAC name is 3-methanidyl-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one;tungsten.
| Compound Name | 3-methanidyl-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one;tungsten |
|---|---|
| PubChem CID | 59974001 |
| Molecular Formula | C10H13N2OW- |
| Molecular Weight | 361.07 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | 3-methanidyl-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one;tungsten |
| SMILES | [CH2-]c1c(C)nc2n(c1=O)CCCC2.[W] |
| InChI | InChI=1S/C10H13N2O.W/c1-7-8(2)11-9-5-3-4-6-12(9)10(7)13;/h1,3-6H2,2H3;/q-1; |
| InChIKey | YBYXLRZRCDORTC-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.07 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|